C14H28 — CID 144746794
ethane;(3Z)-3-ethyl-6-methyl-5-methylidenehepta-1,3-diene;methane (PubChem CID 144746794) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is ethane;(3Z)-3-ethyl-6-methyl-5-methylidenehepta-1,3-diene;methane.
| Compound Name | ethane;(3Z)-3-ethyl-6-methyl-5-methylidenehepta-1,3-diene;methane |
|---|---|
| PubChem CID | 144746794 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | ethane;(3Z)-3-ethyl-6-methyl-5-methylidenehepta-1,3-diene;methane |
| SMILES | C.C=C/C(=C\C(=C)C(C)C)CC.CC |
| InChI | InChI=1S/C11H18.C2H6.CH4/c1-6-11(7-2)8-10(5)9(3)4;1-2;/h6,8-9H,1,5,7H2,2-4H3;1-2H3;1H4/b11-8+;; |
| InChIKey | CERDEOQRSFKVGV-OHENRDTHSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|