C17H32 — CID 145476448
ethane;(3Z)-hexa-1,3,5-triene;4-methyl-3-methylidenepent-1-ene (PubChem CID 145476448) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is ethane;(3Z)-hexa-1,3,5-triene;4-methyl-3-methylidenepent-1-ene.
| Compound Name | ethane;(3Z)-hexa-1,3,5-triene;4-methyl-3-methylidenepent-1-ene |
|---|---|
| PubChem CID | 145476448 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | ethane;(3Z)-hexa-1,3,5-triene;4-methyl-3-methylidenepent-1-ene |
| SMILES | C=C/C=C\C=C.C=CC(=C)C(C)C.CC.CC |
| InChI | InChI=1S/C7H12.C6H8.2C2H6/c1-5-7(4)6(2)3;1-3-5-6-4-2;2*1-2/h5-6H,1,4H2,2-3H3;3-6H,1-2H2;2*1-2H3/b;6-5-;; |
| InChIKey | GXIGVJFNEITCKA-IMZIEXLQSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|