C13H28 — CID 162518558
ethane;methane;(3Z)-3-propan-2-ylhexa-1,3,5-triene (PubChem CID 162518558) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is ethane;methane;(3Z)-3-propan-2-ylhexa-1,3,5-triene.
| Compound Name | ethane;methane;(3Z)-3-propan-2-ylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 162518558 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | ethane;methane;(3Z)-3-propan-2-ylhexa-1,3,5-triene |
| SMILES | C.C.C=C/C=C(\C=C)C(C)C.CC |
| InChI | InChI=1S/C9H14.C2H6.2CH4/c1-5-7-9(6-2)8(3)4;1-2;;/h5-8H,1-2H2,3-4H3;1-2H3;2*1H4/b9-7+;;; |
| InChIKey | DXOICCFMEADYTO-UVUKSMQLSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|