C11H17N — CID 174337124
N-[(2Z,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]methanimine (PubChem CID 174337124) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[(2Z,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]methanimine.
| Compound Name | N-[(2Z,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]methanimine |
|---|---|
| PubChem CID | 174337124 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[(2Z,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]methanimine |
| SMILES | C=C/C(=C\C=C(\C)N=C)C(C)C |
| InChI | InChI=1S/C11H17N/c1-6-11(9(2)3)8-7-10(4)12-5/h6-9H,1,5H2,2-4H3/b10-7-,11-8+ |
| InChIKey | ZBRGEEDXMQULAM-BDLVGCLISA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|