C6H9ClN2 — CID 89064716
(1E,3Z)-1-chloro-4-(methylideneamino)penta-1,3-dien-1-amine (PubChem CID 89064716) has the molecular formula C6H9ClN2 and a molecular weight of 144.60 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-4-(methylideneamino)penta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-1-chloro-4-(methylideneamino)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 89064716 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | (1E,3Z)-1-chloro-4-(methylideneamino)penta-1,3-dien-1-amine |
| SMILES | C=N/C(C)=C\C=C(/N)Cl |
| InChI | InChI=1S/C6H9ClN2/c1-5(9-2)3-4-6(7)8/h3-4H,2,8H2,1H3/b5-3-,6-4- |
| InChIKey | YTAMUDBVSWFHHK-GLIMQPGKSA-N |
| XLogP | 1.63 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|