C11H23N — CID 178156046
ethane;methane;(2Z)-2-propan-2-ylpenta-2,4-dien-1-imine (PubChem CID 178156046) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;methane;(2Z)-2-propan-2-ylpenta-2,4-dien-1-imine.
| Compound Name | ethane;methane;(2Z)-2-propan-2-ylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 178156046 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;methane;(2Z)-2-propan-2-ylpenta-2,4-dien-1-imine |
| SMILES | C.CC.[H]/N=C/C(=C\C=C)C(C)C |
| InChI | InChI=1S/C8H13N.C2H6.CH4/c1-4-5-8(6-9)7(2)3;1-2;/h4-7,9H,1H2,2-3H3;1-2H3;1H4/b8-5+,9-6+;; |
| InChIKey | KRKUNOAFTPYAHG-MLHUQVQXSA-N |
| XLogP | 4.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|