C11H21N — CID 142253668
ethane;(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine (PubChem CID 142253668) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is ethane;(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine.
| Compound Name | ethane;(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 142253668 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | ethane;(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine |
| SMILES | C=C/C=C(\C=C/C)C(C)N.CC |
| InChI | InChI=1S/C9H15N.C2H6/c1-4-6-9(7-5-2)8(3)10;1-2/h4-8H,1,10H2,2-3H3;1-2H3/b7-5-,9-6+; |
| InChIKey | LBRGROLOXRCOLV-UKRQJTKBSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|