C17H26ClI — CID 142578405
(3E,7E,8Z)-7-(1-chloroethylidene)-5-iodo-4-[(Z)-prop-1-enyl]deca-1,3,8-triene;ethane (PubChem CID 142578405) has the molecular formula C17H26ClI and a molecular weight of 392.75 g/mol. Its IUPAC name is (3E,7E,8Z)-7-(1-chloroethylidene)-5-iodo-4-[(Z)-prop-1-enyl]deca-1,3,8-triene;ethane.
| Compound Name | (3E,7E,8Z)-7-(1-chloroethylidene)-5-iodo-4-[(Z)-prop-1-enyl]deca-1,3,8-triene;ethane |
|---|---|
| PubChem CID | 142578405 |
| Molecular Formula | C17H26ClI |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (3E,7E,8Z)-7-(1-chloroethylidene)-5-iodo-4-[(Z)-prop-1-enyl]deca-1,3,8-triene;ethane |
| SMILES | C=C/C=C(\C=C/C)C(I)CC(/C=C\C)=C(/C)Cl.CC |
| InChI | InChI=1S/C15H20ClI.C2H6/c1-5-8-13(9-6-2)15(17)11-14(10-7-3)12(4)16;1-2/h5-10,15H,1,11H2,2-4H3;1-2H3/b9-6-,10-7-,13-8+,14-12-; |
| InChIKey | HDXLQMCWCZKIGA-DPILFSDISA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|