C11H20S — CID 142823912
ethane;(3E,5Z)-4-(methylsulfanylmethyl)hepta-1,3,5-triene (PubChem CID 142823912) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-(methylsulfanylmethyl)hepta-1,3,5-triene.
| Compound Name | ethane;(3E,5Z)-4-(methylsulfanylmethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 142823912 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | ethane;(3E,5Z)-4-(methylsulfanylmethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/C)CSC.CC |
| InChI | InChI=1S/C9H14S.C2H6/c1-4-6-9(7-5-2)8-10-3;1-2/h4-7H,1,8H2,2-3H3;1-2H3/b7-5-,9-6+; |
| InChIKey | SBROSTNPVZLVAZ-UKRQJTKBSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|