C14H22O — CID 143973281
(3E,5Z)-4-(hex-5-enoxymethyl)hepta-1,3,5-triene (PubChem CID 143973281) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (3E,5Z)-4-(hex-5-enoxymethyl)hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-(hex-5-enoxymethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143973281 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (3E,5Z)-4-(hex-5-enoxymethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/C)COCCCCC=C |
| InChI | InChI=1S/C14H22O/c1-4-7-8-9-12-15-13-14(10-5-2)11-6-3/h4-6,10-11H,1-2,7-9,12-13H2,3H3/b11-6-,14-10+ |
| InChIKey | MHTUPZBDIIMKQG-HNPFEXMKSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|