C9H15BrO — CID 145079816
(2E,4Z)-3-(2-bromoethoxymethyl)hexa-2,4-diene (PubChem CID 145079816) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is (2E,4Z)-3-(2-bromoethoxymethyl)hexa-2,4-diene.
| Compound Name | (2E,4Z)-3-(2-bromoethoxymethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 145079816 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (2E,4Z)-3-(2-bromoethoxymethyl)hexa-2,4-diene |
| SMILES | C/C=C\C(=C/C)COCCBr |
| InChI | InChI=1S/C9H15BrO/c1-3-5-9(4-2)8-11-7-6-10/h3-5H,6-8H2,1-2H3/b5-3-,9-4+ |
| InChIKey | CVBBTSMWJNFXOV-LWUTYWFWSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|