C8H16O2 — CID 144920748
(Z,2E)-2-ethylidenepent-3-en-1-ol;methanol (PubChem CID 144920748) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (Z,2E)-2-ethylidenepent-3-en-1-ol;methanol.
| Compound Name | (Z,2E)-2-ethylidenepent-3-en-1-ol;methanol |
|---|---|
| PubChem CID | 144920748 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (Z,2E)-2-ethylidenepent-3-en-1-ol;methanol |
| SMILES | C/C=C\C(=C/C)CO.CO |
| InChI | InChI=1S/C7H12O.CH4O/c1-3-5-7(4-2)6-8;1-2/h3-5,8H,6H2,1-2H3;2H,1H3/b5-3-,7-4+; |
| InChIKey | LMSWHMILKUZWSG-JQEBEGLOSA-N |
| XLogP | 1.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|