C9H18S — CID 143332948
ethane;(Z,2E)-2-ethylidenepent-3-ene-1-thiol (PubChem CID 143332948) has the molecular formula C9H18S and a molecular weight of 158.31 g/mol. Its IUPAC name is ethane;(Z,2E)-2-ethylidenepent-3-ene-1-thiol.
| Compound Name | ethane;(Z,2E)-2-ethylidenepent-3-ene-1-thiol |
|---|---|
| PubChem CID | 143332948 |
| Molecular Formula | C9H18S |
| Molecular Weight | 158.31 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | ethane;(Z,2E)-2-ethylidenepent-3-ene-1-thiol |
| SMILES | C/C=C\C(=C/C)CS.CC |
| InChI | InChI=1S/C7H12S.C2H6/c1-3-5-7(4-2)6-8;1-2/h3-5,8H,6H2,1-2H3;1-2H3/b5-3-,7-4+; |
| InChIKey | NBXFVZWJCXUJLC-JQEBEGLOSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|