C14H30 — CID 144709527
ethane;ethene;(2Z,4Z)-3-ethylhexa-2,4-diene (PubChem CID 144709527) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is ethane;ethene;(2Z,4Z)-3-ethylhexa-2,4-diene.
| Compound Name | ethane;ethene;(2Z,4Z)-3-ethylhexa-2,4-diene |
|---|---|
| PubChem CID | 144709527 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | ethane;ethene;(2Z,4Z)-3-ethylhexa-2,4-diene |
| SMILES | C/C=C\C(=C/C)CC.C=C.CC.CC |
| InChI | InChI=1S/C8H14.2C2H6.C2H4/c1-4-7-8(5-2)6-3;3*1-2/h4-5,7H,6H2,1-3H3;2*1-2H3;1-2H2/b7-4-,8-5-;;; |
| InChIKey | VAYHELIKRXOAMT-QQAMBCKTSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|