C12H18N2 — CID 156548687
(2Z,6Z,8Z)-8-ethyldeca-2,6,8-triene-4,5-diimine (PubChem CID 156548687) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2Z,6Z,8Z)-8-ethyldeca-2,6,8-triene-4,5-diimine.
| Compound Name | (2Z,6Z,8Z)-8-ethyldeca-2,6,8-triene-4,5-diimine |
|---|---|
| PubChem CID | 156548687 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (2Z,6Z,8Z)-8-ethyldeca-2,6,8-triene-4,5-diimine |
| SMILES | [H]N=C(/C=C\C(=C/C)CC)C(/C=C\C)=N/[H] |
| InChI | InChI=1S/C12H18N2/c1-4-7-11(13)12(14)9-8-10(5-2)6-3/h4-5,7-9,13-14H,6H2,1-3H3/b7-4-,9-8-,10-5-,13-11+,14-12- |
| InChIKey | BXHDPYHCPBZZNU-ORKPPJCKSA-N |
| XLogP | 3.51 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|