C12H16FN — CID 135254636
(5E,6Z)-5-ethylidene-8-fluoro-2-methylnona-2,6,8-trien-4-imine (PubChem CID 135254636) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (5E,6Z)-5-ethylidene-8-fluoro-2-methylnona-2,6,8-trien-4-imine.
| Compound Name | (5E,6Z)-5-ethylidene-8-fluoro-2-methylnona-2,6,8-trien-4-imine |
|---|---|
| PubChem CID | 135254636 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (5E,6Z)-5-ethylidene-8-fluoro-2-methylnona-2,6,8-trien-4-imine |
| SMILES | [H]N=C(C=C(C)C)C(/C=C\C(=C)F)=C/C |
| InChI | InChI=1S/C12H16FN/c1-5-11(7-6-10(4)13)12(14)8-9(2)3/h5-8,14H,4H2,1-3H3/b7-6-,11-5+,14-12+ |
| InChIKey | CWSJJBUODUCJQW-OYIWAQKHSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|