C8H10F3N — CID 122417254
(3E,5Z)-3-(trifluoromethyl)hepta-3,5-dien-2-imine (PubChem CID 122417254) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is (3E,5Z)-3-(trifluoromethyl)hepta-3,5-dien-2-imine.
| Compound Name | (3E,5Z)-3-(trifluoromethyl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 122417254 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3E,5Z)-3-(trifluoromethyl)hepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(=C\C=C/C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-3-4-5-7(6(2)12)8(9,10)11/h3-5,12H,1-2H3/b4-3-,7-5+,12-6+ |
| InChIKey | MQWSGEXGZQLFAC-QDLZVNSMSA-N |
| XLogP | 3.09 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|