C10H11F6N — CID 123298954
5-methyl-3,4-bis(trifluoromethyl)hepta-3,5-dien-2-imine (PubChem CID 123298954) has the molecular formula C10H11F6N and a molecular weight of 259.19 g/mol. Its IUPAC name is 5-methyl-3,4-bis(trifluoromethyl)hepta-3,5-dien-2-imine.
| Compound Name | 5-methyl-3,4-bis(trifluoromethyl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123298954 |
| Molecular Formula | C10H11F6N |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-methyl-3,4-bis(trifluoromethyl)hepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(\C)C(=C(C(C)=CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F6N/c1-4-5(2)7(9(11,12)13)8(6(3)17)10(14,15)16/h4,17H,1-3H3/b5-4?,8-7?,17-6+ |
| InChIKey | UBPOQQALUYMCHG-XYWTWQNMSA-N |
| XLogP | 4.41 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|