C8H5F10N — CID 134996532
(E)-1,1,1,2,2,6,6,7,7,7-decafluoro-4-methylhept-4-en-3-imine (PubChem CID 134996532) has the molecular formula C8H5F10N and a molecular weight of 305.12 g/mol. Its IUPAC name is (E)-1,1,1,2,2,6,6,7,7,7-decafluoro-4-methylhept-4-en-3-imine.
| Compound Name | (E)-1,1,1,2,2,6,6,7,7,7-decafluoro-4-methylhept-4-en-3-imine |
|---|---|
| PubChem CID | 134996532 |
| Molecular Formula | C8H5F10N |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | (E)-1,1,1,2,2,6,6,7,7,7-decafluoro-4-methylhept-4-en-3-imine |
| SMILES | [H]/N=C(C(\C)=C\C(F)(F)C(F)(F)F)/C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F10N/c1-3(2-5(9,10)7(13,14)15)4(19)6(11,12)8(16,17)18/h2,19H,1H3/b3-2+,19-4+ |
| InChIKey | SFLVETBKONDNLP-AOQWUMTISA-N |
| XLogP | 4.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|