C8H5F6N — CID 163897844
3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-imine (PubChem CID 163897844) has the molecular formula C8H5F6N and a molecular weight of 229.12 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | 3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 163897844 |
| Molecular Formula | C8H5F6N |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=C(C(F)(F)F)C=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H5F6N/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-2,15H,3H2/b15-6- |
| InChIKey | QHFRUBHBYMQTMP-UUASQNMZSA-N |
| XLogP | 3.39 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|