C8H7F4N — CID 123223996
4-ethenyl-2,3,5,6-tetrafluorocyclohex-3-en-1-imine (PubChem CID 123223996) has the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. Its IUPAC name is 4-ethenyl-2,3,5,6-tetrafluorocyclohex-3-en-1-imine.
| Compound Name | 4-ethenyl-2,3,5,6-tetrafluorocyclohex-3-en-1-imine |
|---|---|
| PubChem CID | 123223996 |
| Molecular Formula | C8H7F4N |
| Molecular Weight | 193.14 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 4-ethenyl-2,3,5,6-tetrafluorocyclohex-3-en-1-imine |
| SMILES | [H]/N=C1\C(F)C(F)=C(C=C)C(F)C1F |
| InChI | InChI=1S/C8H7F4N/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2,4,6-7,13H,1H2/b13-8- |
| InChIKey | FGYKGZCQHOEIOA-JYRVWZFOSA-N |
| XLogP | 2.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|