C8H8F3N — CID 123335440
2-(trifluoromethyl)cyclohepta-2,4-dien-1-imine (PubChem CID 123335440) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-(trifluoromethyl)cyclohepta-2,4-dien-1-imine.
| Compound Name | 2-(trifluoromethyl)cyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123335440 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-(trifluoromethyl)cyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1\CCC=CC=C1C(F)(F)F |
| InChI | InChI=1S/C8H8F3N/c9-8(10,11)6-4-2-1-3-5-7(6)12/h1-2,4,12H,3,5H2/b12-7+ |
| InChIKey | UTYQQKGISATOGW-KPKJPENVSA-N |
| XLogP | 2.84 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|