C11H18F3N — CID 143344370
ethane;(5Z,7E)-9,9,9-trifluoronona-5,7-dien-4-imine (PubChem CID 143344370) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is ethane;(5Z,7E)-9,9,9-trifluoronona-5,7-dien-4-imine.
| Compound Name | ethane;(5Z,7E)-9,9,9-trifluoronona-5,7-dien-4-imine |
|---|---|
| PubChem CID | 143344370 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethane;(5Z,7E)-9,9,9-trifluoronona-5,7-dien-4-imine |
| SMILES | CC.[H]/N=C(/C=C\C=C\C(F)(F)F)CCC |
| InChI | InChI=1S/C9H12F3N.C2H6/c1-2-5-8(13)6-3-4-7-9(10,11)12;1-2/h3-4,6-7,13H,2,5H2,1H3;1-2H3/b6-3-,7-4+,13-8+; |
| InChIKey | VAWMFJMIHZIDND-LVQOCNIUSA-N |
| XLogP | 4.51 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|