C8H11F2N — CID 123446884
(4Z)-6,7-difluoroocta-4,6-dien-2-imine (PubChem CID 123446884) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is (4Z)-6,7-difluoroocta-4,6-dien-2-imine.
| Compound Name | (4Z)-6,7-difluoroocta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 123446884 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (4Z)-6,7-difluoroocta-4,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C/C=C\C(F)=C(C)F |
| InChI | InChI=1S/C8H11F2N/c1-6(11)4-3-5-8(10)7(2)9/h3,5,11H,4H2,1-2H3/b5-3-,8-7?,11-6+ |
| InChIKey | CJJHRXINMGYPJM-XKCQWDPWSA-N |
| XLogP | 3.14 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|