About (4E)-5-fluorohepta-4,6-dien-3-imine
(4E)-5-fluorohepta-4,6-dien-3-imine (PubChem CID 123678972) has the molecular formula C7H10FN
and a molecular weight of 127.16 g/mol. Its IUPAC name is (4E)-5-fluorohepta-4,6-dien-3-imine.
Molecular Properties
| Compound Name | (4E)-5-fluorohepta-4,6-dien-3-imine |
| PubChem CID | 123678972 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (4E)-5-fluorohepta-4,6-dien-3-imine |
| SMILES | [H]/N=C(/C=C(/F)C=C)CC |
| InChI | InChI=1S/C7H10FN/c1-3-6(8)5-7(9)4-2/h3,5,9H,1,4H2,2H3/b6-5+,9-7+ |
| InChIKey | SXERXZMSSOFZHH-SBIWHPGTSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-fluorohepta-4,6-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-fluorohepta-4,6-dien-3-imine?
The IUPAC name of (4E)-5-fluorohepta-4,6-dien-3-imine (CID 123678972) is (4E)-5-fluorohepta-4,6-dien-3-imine.
What is the SMILES notation for (4E)-5-fluorohepta-4,6-dien-3-imine?
The canonical SMILES for (4E)-5-fluorohepta-4,6-dien-3-imine is [H]/N=C(/C=C(/F)C=C)CC.
What is the InChIKey of (4E)-5-fluorohepta-4,6-dien-3-imine?
The InChIKey is SXERXZMSSOFZHH-SBIWHPGTSA-N. The full InChI is InChI=1S/C7H10FN/c1-3-6(8)5-7(9)4-2/h3,5,9H,1,4H2,2H3/b6-5+,9-7+.
What are the key properties of (4E)-5-fluorohepta-4,6-dien-3-imine?
(4E)-5-fluorohepta-4,6-dien-3-imine has a molecular weight of 127.16 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-fluorohepta-4,6-dien-3-imine is sourced from PubChem (CID 123678972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).