C7H5F3N2 — CID 143271066
4-(trifluoromethyl)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 143271066) has the molecular formula C7H5F3N2 and a molecular weight of 174.12 g/mol. Its IUPAC name is 4-(trifluoromethyl)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 4-(trifluoromethyl)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 143271066 |
| Molecular Formula | C7H5F3N2 |
| Molecular Weight | 174.12 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 4-(trifluoromethyl)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C=CC(C(F)(F)F)=C\C1=N/[H] |
| InChI | InChI=1S/C7H5F3N2/c8-7(9,10)4-1-2-5(11)6(12)3-4/h1-3,11-12H/b11-5+,12-6+ |
| InChIKey | PISUCXVUHKVKEG-YDWXAUTNSA-N |
| XLogP | 2.08 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|