C11H14F3N — CID 145152058
(4E,6E)-8,8,8-trifluoro-4,7-dimethyl-3-methylideneocta-4,6-dien-2-imine (PubChem CID 145152058) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is (4E,6E)-8,8,8-trifluoro-4,7-dimethyl-3-methylideneocta-4,6-dien-2-imine.
| Compound Name | (4E,6E)-8,8,8-trifluoro-4,7-dimethyl-3-methylideneocta-4,6-dien-2-imine |
|---|---|
| PubChem CID | 145152058 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (4E,6E)-8,8,8-trifluoro-4,7-dimethyl-3-methylideneocta-4,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C(=C)/C(C)=C/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N/c1-7(9(3)10(4)15)5-6-8(2)11(12,13)14/h5-6,15H,3H2,1-2,4H3/b7-5+,8-6+,15-10+ |
| InChIKey | ASWQJNASPFWMDU-GNPOWSKUSA-N |
| XLogP | 4.04 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|