C18H5F30N — CID 134932493
(E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-triacontafluoro-9-methylheptadec-9-en-8-imine (PubChem CID 134932493) has the molecular formula C18H5F30N and a molecular weight of 805.18 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-triacontafluoro-9-methylheptadec-9-en-8-imine.
| Compound Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-triacontafluoro-9-methylheptadec-9-en-8-imine |
|---|---|
| PubChem CID | 134932493 |
| Molecular Formula | C18H5F30N |
| Molecular Weight | 805.18 g/mol |
| Exact Mass | 804.99 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-triacontafluoro-9-methylheptadec-9-en-8-imine |
| SMILES | [H]/N=C(C(\C)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H5F30N/c1-3(2-5(19,20)7(23,24)9(27,28)11(31,32)13(35,36)15(39,40)17(43,44)45)4(49)6(21,22)8(25,26)10(29,30)12(33,34)14(37,38)16(41,42)18(46,47)48/h2,49H,1H3/b3-2+,49-4+ |
| InChIKey | GXIUWBVHOBYQRC-VMTKLORDSA-N |
| XLogP | 10.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.18 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|