C13H26 — CID 145142585
ethane;(3Z,5Z)-5-ethylhepta-1,3,5-triene (PubChem CID 145142585) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is ethane;(3Z,5Z)-5-ethylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-5-ethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 145142585 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | ethane;(3Z,5Z)-5-ethylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)CC.CC.CC |
| InChI | InChI=1S/C9H14.2C2H6/c1-4-7-8-9(5-2)6-3;2*1-2/h4-5,7-8H,1,6H2,2-3H3;2*1-2H3/b8-7-,9-5-;; |
| InChIKey | BKHNCWZGMBWJKA-UPZVCZHESA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|