C16H31N — CID 144845989
(2E,3Z)-N-ethyl-2-ethylidene-N-propylhexa-3,5-dien-1-amine;propane (PubChem CID 144845989) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (2E,3Z)-N-ethyl-2-ethylidene-N-propylhexa-3,5-dien-1-amine;propane.
| Compound Name | (2E,3Z)-N-ethyl-2-ethylidene-N-propylhexa-3,5-dien-1-amine;propane |
|---|---|
| PubChem CID | 144845989 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (2E,3Z)-N-ethyl-2-ethylidene-N-propylhexa-3,5-dien-1-amine;propane |
| SMILES | C=C/C=C\C(=C/C)CN(CC)CCC.CCC |
| InChI | InChI=1S/C13H23N.C3H8/c1-5-9-10-13(7-3)12-14(8-4)11-6-2;1-3-2/h5,7,9-10H,1,6,8,11-12H2,2-4H3;3H2,1-2H3/b10-9-,13-7+; |
| InChIKey | NYYQUHZVQHOJTL-RESLJMQWSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|