About ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine
ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine (PubChem CID 143677797) has the molecular formula C15H33NO
and a molecular weight of 243.43 g/mol. Its IUPAC name is ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine.
Molecular Properties
| Compound Name | ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine |
| PubChem CID | 143677797 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine |
| SMILES | C=C/C(=C\C)CN(CC)CCOC.CC.CC |
| InChI | InChI=1S/C11H21NO.2C2H6/c1-5-11(6-2)10-12(7-3)8-9-13-4;2*1-2/h5-6H,1,7-10H2,2-4H3;2*1-2H3/b11-6+;; |
| InChIKey | XGVKKBPFZFOGAK-QVLKBJGCSA-N |
| XLogP | 4.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine?
The IUPAC name of ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine (CID 143677797) is ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine.
What is the SMILES notation for ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine?
The canonical SMILES for ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine is C=C/C(=C\C)CN(CC)CCOC.CC.CC.
What is the InChIKey of ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine?
The InChIKey is XGVKKBPFZFOGAK-QVLKBJGCSA-N. The full InChI is InChI=1S/C11H21NO.2C2H6/c1-5-11(6-2)10-12(7-3)8-9-13-4;2*1-2/h5-6H,1,7-10H2,2-4H3;2*1-2H3/b11-6+;;.
What are the key properties of ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine?
ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine has a molecular weight of 243.43 g/mol, XLogP of 4.14, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-2-ethenyl-N-ethyl-N-(2-methoxyethyl)but-2-en-1-amine is sourced from PubChem (CID 143677797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).