C15H28N2 — CID 130183526
N'-ethyl-N'-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]-N,N-dimethylethane-1,2-diamine (PubChem CID 130183526) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N'-ethyl-N'-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 130183526 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N'-ethyl-N'-[(2E,3Z)-2-ethylidenehepta-3,6-dienyl]-N,N-dimethylethane-1,2-diamine |
| SMILES | C=CC/C=C\C(=C/C)CN(CC)CCN(C)C |
| InChI | InChI=1S/C15H28N2/c1-6-9-10-11-15(7-2)14-17(8-3)13-12-16(4)5/h6-7,10-11H,1,8-9,12-14H2,2-5H3/b11-10-,15-7+ |
| InChIKey | DFJLCSTZYMAWOG-LVDYVNFFSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|