C13H24 — CID 143827979
ethane;(4Z,6E)-6-ethylnona-1,4,6-triene (PubChem CID 143827979) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is ethane;(4Z,6E)-6-ethylnona-1,4,6-triene.
| Compound Name | ethane;(4Z,6E)-6-ethylnona-1,4,6-triene |
|---|---|
| PubChem CID | 143827979 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | ethane;(4Z,6E)-6-ethylnona-1,4,6-triene |
| SMILES | C=CC/C=C\C(=C\CC)CC.CC |
| InChI | InChI=1S/C11H18.C2H6/c1-4-7-8-10-11(6-3)9-5-2;1-2/h4,8-10H,1,5-7H2,2-3H3;1-2H3/b10-8-,11-9+; |
| InChIKey | CTUOTLWEOSEMBW-UXFBNDMYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|