C12H16O — CID 130348928
(4Z,6E)-6-prop-2-ynoxynona-1,4,6-triene (PubChem CID 130348928) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (4Z,6E)-6-prop-2-ynoxynona-1,4,6-triene.
| Compound Name | (4Z,6E)-6-prop-2-ynoxynona-1,4,6-triene |
|---|---|
| PubChem CID | 130348928 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (4Z,6E)-6-prop-2-ynoxynona-1,4,6-triene |
| SMILES | C#CCOC(/C=C\CC=C)=C/CC |
| InChI | InChI=1S/C12H16O/c1-4-7-8-10-12(9-5-2)13-11-6-3/h3-4,8-10H,1,5,7,11H2,2H3/b10-8-,12-9+ |
| InChIKey | POSNETBFPMQKAS-XXBUAHSKSA-N |
| XLogP | 3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|