C12H22O — CID 134857927
(2E,4E)-4-ethoxydeca-2,4-diene (PubChem CID 134857927) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (2E,4E)-4-ethoxydeca-2,4-diene.
| Compound Name | (2E,4E)-4-ethoxydeca-2,4-diene |
|---|---|
| PubChem CID | 134857927 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (2E,4E)-4-ethoxydeca-2,4-diene |
| SMILES | C/C=C/C(=C\CCCCC)OCC |
| InChI | InChI=1S/C12H22O/c1-4-7-8-9-11-12(10-5-2)13-6-3/h5,10-11H,4,6-9H2,1-3H3/b10-5+,12-11+ |
| InChIKey | PGMJEKJYMAFWLT-WKWSCTOISA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|