C12H22O — CID 130374404
(3E,5Z)-4-(propoxymethyl)octa-3,5-diene (PubChem CID 130374404) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (3E,5Z)-4-(propoxymethyl)octa-3,5-diene.
| Compound Name | (3E,5Z)-4-(propoxymethyl)octa-3,5-diene |
|---|---|
| PubChem CID | 130374404 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (3E,5Z)-4-(propoxymethyl)octa-3,5-diene |
| SMILES | CC/C=C\C(=C/CC)COCCC |
| InChI | InChI=1S/C12H22O/c1-4-7-9-12(8-5-2)11-13-10-6-3/h7-9H,4-6,10-11H2,1-3H3/b9-7-,12-8+ |
| InChIKey | CVXQUFKSRWNORN-ZUQSVMQASA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|