C8H14OS — CID 142317343
(2Z,4E)-4-(sulfanyloxymethyl)hepta-2,4-diene (PubChem CID 142317343) has the molecular formula C8H14OS and a molecular weight of 158.27 g/mol. Its IUPAC name is (2Z,4E)-4-(sulfanyloxymethyl)hepta-2,4-diene.
| Compound Name | (2Z,4E)-4-(sulfanyloxymethyl)hepta-2,4-diene |
|---|---|
| PubChem CID | 142317343 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (2Z,4E)-4-(sulfanyloxymethyl)hepta-2,4-diene |
| SMILES | C/C=C\C(=C/CC)COS |
| InChI | InChI=1S/C8H14OS/c1-3-5-8(6-4-2)7-9-10/h3,5-6,10H,4,7H2,1-2H3/b5-3-,8-6+ |
| InChIKey | UIRJNXBHKKTGNX-CUKJDEOPSA-N |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|