C12H21NO2 — CID 142103605
[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-propylcarbamate (PubChem CID 142103605) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-propylcarbamate.
| Compound Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-propylcarbamate |
|---|---|
| PubChem CID | 142103605 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-propylcarbamate |
| SMILES | C/C=C\C(=C/CC)COC(=O)NCCC |
| InChI | InChI=1S/C12H21NO2/c1-4-7-11(8-5-2)10-15-12(14)13-9-6-3/h4,7-8H,5-6,9-10H2,1-3H3,(H,13,14)/b7-4-,11-8+ |
| InChIKey | FJIGVHVAUGKEJT-AFDHTILLSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|