C18H26N2O3 — CID 144729713
[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene (PubChem CID 144729713) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene.
| Compound Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene |
|---|---|
| PubChem CID | 144729713 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene |
| SMILES | C/C=C\C(=C/CC)COC(=O)NCC(N)=O.Cc1ccccc1 |
| InChI | InChI=1S/C11H18N2O3.C7H8/c1-3-5-9(6-4-2)8-16-11(15)13-7-10(12)14;1-7-5-3-2-4-6-7/h3,5-6H,4,7-8H2,1-2H3,(H2,12,14)(H,13,15);2-6H,1H3/b5-3-,9-6+; |
| InChIKey | RIDOVMWAHOPCAW-XRVNEYCPSA-N |
| XLogP | 3.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|