About [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene
[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene (PubChem CID 144729713) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene.
Molecular Properties
| Compound Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene |
| PubChem CID | 144729713 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene |
| SMILES | C/C=C\C(=C/CC)COC(=O)NCC(N)=O.Cc1ccccc1 |
| InChI | InChI=1S/C11H18N2O3.C7H8/c1-3-5-9(6-4-2)8-16-11(15)13-7-10(12)14;1-7-5-3-2-4-6-7/h3,5-6H,4,7-8H2,1-2H3,(H2,12,14)(H,13,15);2-6H,1H3/b5-3-,9-6+; |
| InChIKey | RIDOVMWAHOPCAW-XRVNEYCPSA-N |
| XLogP | 3.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene?
The IUPAC name of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene (CID 144729713) is [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene.
What is the SMILES notation for [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene?
The canonical SMILES for [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene is C/C=C\C(=C/CC)COC(=O)NCC(N)=O.Cc1ccccc1.
What is the InChIKey of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene?
The InChIKey is RIDOVMWAHOPCAW-XRVNEYCPSA-N. The full InChI is InChI=1S/C11H18N2O3.C7H8/c1-3-5-9(6-4-2)8-16-11(15)13-7-10(12)14;1-7-5-3-2-4-6-7/h3,5-6H,4,7-8H2,1-2H3,(H2,12,14)(H,13,15);2-6H,1H3/b5-3-,9-6+;.
What are the key properties of [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene?
[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene has a molecular weight of 318.42 g/mol, XLogP of 3.11, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate;toluene is sourced from PubChem (CID 144729713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).