C7H12O2 — CID 89084201
(2E,4Z)-3-(hydroperoxymethyl)hexa-2,4-diene (PubChem CID 89084201) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (2E,4Z)-3-(hydroperoxymethyl)hexa-2,4-diene.
| Compound Name | (2E,4Z)-3-(hydroperoxymethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 89084201 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (2E,4Z)-3-(hydroperoxymethyl)hexa-2,4-diene |
| SMILES | C/C=C\C(=C/C)COO |
| InChI | InChI=1S/C7H12O2/c1-3-5-7(4-2)6-9-8/h3-5,8H,6H2,1-2H3/b5-3-,7-4+ |
| InChIKey | SXURBUWAXHGZDE-XKSOLRDRSA-N |
| XLogP | 2.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|