C16H22O — CID 167457569
1-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-propylbenzene (PubChem CID 167457569) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-propylbenzene.
| Compound Name | 1-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-propylbenzene |
|---|---|
| PubChem CID | 167457569 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-propylbenzene |
| SMILES | C/C=C\C(=C/C)COc1ccc(CCC)cc1 |
| InChI | InChI=1S/C16H22O/c1-4-7-14(6-3)13-17-16-11-9-15(8-5-2)10-12-16/h4,6-7,9-12H,5,8,13H2,1-3H3/b7-4-,14-6+ |
| InChIKey | BINNENCQLFJMDE-QWPDWJTASA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|