C14H17NO3 — CID 163634351
N-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-hydroxybenzamide (PubChem CID 163634351) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-hydroxybenzamide.
| Compound Name | N-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 163634351 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[(Z,2E)-2-ethylidenepent-3-enoxy]-4-hydroxybenzamide |
| SMILES | C/C=C\C(=C/C)CONC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H17NO3/c1-3-5-11(4-2)10-18-15-14(17)12-6-8-13(16)9-7-12/h3-9,16H,10H2,1-2H3,(H,15,17)/b5-3-,11-4+ |
| InChIKey | HYVNBAWMTBLHQC-DVJFJSKXSA-N |
| XLogP | 2.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|