About (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol
(E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol (PubChem CID 178150271) has the molecular formula C13H21NO2S
and a molecular weight of 255.38 g/mol. Its IUPAC name is (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol.
Molecular Properties
| Compound Name | (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol |
| PubChem CID | 178150271 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol |
| SMILES | C/C=C/C.CNC(=O)c1ccc(O)cc1.CS |
| InChI | InChI=1S/C8H9NO2.C4H8.CH4S/c1-9-8(11)6-2-4-7(10)5-3-6;1-3-4-2;1-2/h2-5,10H,1H3,(H,9,11);3-4H,1-2H3;2H,1H3/b;4-3+; |
| InChIKey | DROSRAZEMUCOQF-ITDJAWRYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol?
The IUPAC name of (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol (CID 178150271) is (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol.
What is the SMILES notation for (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol?
The canonical SMILES for (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol is C/C=C/C.CNC(=O)c1ccc(O)cc1.CS.
What is the InChIKey of (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol?
The InChIKey is DROSRAZEMUCOQF-ITDJAWRYSA-N. The full InChI is InChI=1S/C8H9NO2.C4H8.CH4S/c1-9-8(11)6-2-4-7(10)5-3-6;1-3-4-2;1-2/h2-5,10H,1H3,(H,9,11);3-4H,1-2H3;2H,1H3/b;4-3+;.
What are the key properties of (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol?
(E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol has a molecular weight of 255.38 g/mol, XLogP of 2.88, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-ene;4-hydroxy-N-methylbenzamide;methanethiol is sourced from PubChem (CID 178150271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).