C15H16O5 — CID 174381920
2-[(2E,4E)-hexa-2,4-dienoyl]oxyethyl 4-hydroxybenzoate (PubChem CID 174381920) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[(2E,4E)-hexa-2,4-dienoyl]oxyethyl 4-hydroxybenzoate.
| Compound Name | 2-[(2E,4E)-hexa-2,4-dienoyl]oxyethyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 174381920 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[(2E,4E)-hexa-2,4-dienoyl]oxyethyl 4-hydroxybenzoate |
| SMILES | C/C=C/C=C/C(=O)OCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O5/c1-2-3-4-5-14(17)19-10-11-20-15(18)12-6-8-13(16)9-7-12/h2-9,16H,10-11H2,1H3/b3-2+,5-4+ |
| InChIKey | YSJOJIJDHWEGNU-MQQKCMAXSA-N |
| XLogP | 2.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|