C14H24O2 — CID 143642417
acetylene;1-[(Z,2E)-2-ethylidenepent-3-enoxy]pentan-2-ol (PubChem CID 143642417) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is acetylene;1-[(Z,2E)-2-ethylidenepent-3-enoxy]pentan-2-ol.
| Compound Name | acetylene;1-[(Z,2E)-2-ethylidenepent-3-enoxy]pentan-2-ol |
|---|---|
| PubChem CID | 143642417 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | acetylene;1-[(Z,2E)-2-ethylidenepent-3-enoxy]pentan-2-ol |
| SMILES | C#C.C/C=C\C(=C/C)COCC(O)CCC |
| InChI | InChI=1S/C12H22O2.C2H2/c1-4-7-11(6-3)9-14-10-12(13)8-5-2;1-2/h4,6-7,12-13H,5,8-10H2,1-3H3;1-2H/b7-4-,11-6+; |
| InChIKey | JXAFKAQUQQEGBQ-YKLNXYNISA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|