C13H22O — CID 143465864
(3E,5Z)-4-(2-methylbutoxymethyl)hepta-1,3,5-triene (PubChem CID 143465864) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (3E,5Z)-4-(2-methylbutoxymethyl)hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-(2-methylbutoxymethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143465864 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (3E,5Z)-4-(2-methylbutoxymethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/C)COCC(C)CC |
| InChI | InChI=1S/C13H22O/c1-5-8-13(9-6-2)11-14-10-12(4)7-3/h5-6,8-9,12H,1,7,10-11H2,2-4H3/b9-6-,13-8+ |
| InChIKey | QYSXHXNCSVFTCG-CMLKFSTMSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|