C22H41F3O — CID 143695948
methane;3-methylundecane;(3E)-1,1,1-trifluoro-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol (PubChem CID 143695948) has the molecular formula C22H41F3O and a molecular weight of 378.56 g/mol. Its IUPAC name is methane;3-methylundecane;(3E)-1,1,1-trifluoro-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol.
| Compound Name | methane;3-methylundecane;(3E)-1,1,1-trifluoro-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 143695948 |
| Molecular Formula | C22H41F3O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | methane;3-methylundecane;(3E)-1,1,1-trifluoro-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol |
| SMILES | C.C=C/C=C(\C=C/C)C(O)C(F)(F)F.CCCCCCCCC(C)CC |
| InChI | InChI=1S/C12H26.C9H11F3O.CH4/c1-4-6-7-8-9-10-11-12(3)5-2;1-3-5-7(6-4-2)8(13)9(10,11)12;/h12H,4-11H2,1-3H3;3-6,8,13H,1H2,2H3;1H4/b;6-4-,7-5+; |
| InChIKey | SQQFNCXVACZNRC-HHEXBWDDSA-N |
| XLogP | 8.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|