C13H23N — CID 142416961
(5Z)-N-ethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine (PubChem CID 142416961) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (5Z)-N-ethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine.
| Compound Name | (5Z)-N-ethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine |
|---|---|
| PubChem CID | 142416961 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (5Z)-N-ethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-3-amine |
| SMILES | C=C/C=C(\C=C/C)CC(CC)NCC |
| InChI | InChI=1S/C13H23N/c1-5-9-12(10-6-2)11-13(7-3)14-8-4/h5-6,9-10,13-14H,1,7-8,11H2,2-4H3/b10-6-,12-9+ |
| InChIKey | WLTGCTFWPBVMRF-ZQNGMKBSSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|