C9H13N — CID 142294235
N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]methanimine (PubChem CID 142294235) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]methanimine.
| Compound Name | N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]methanimine |
|---|---|
| PubChem CID | 142294235 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]methanimine |
| SMILES | C=C/C=C(\C=C/C)CN=C |
| InChI | InChI=1S/C9H13N/c1-4-6-9(7-5-2)8-10-3/h4-7H,1,3,8H2,2H3/b7-5-,9-6+ |
| InChIKey | QKMPIAHSQZJMBI-XCZNYUDNSA-N |
| XLogP | 2.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|