C10H12FN — CID 142913484
N-[(E)-4-fluoro-2-[(Z)-prop-1-enyl]hex-2-en-5-ynyl]methanimine (PubChem CID 142913484) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is N-[(E)-4-fluoro-2-[(Z)-prop-1-enyl]hex-2-en-5-ynyl]methanimine.
| Compound Name | N-[(E)-4-fluoro-2-[(Z)-prop-1-enyl]hex-2-en-5-ynyl]methanimine |
|---|---|
| PubChem CID | 142913484 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N-[(E)-4-fluoro-2-[(Z)-prop-1-enyl]hex-2-en-5-ynyl]methanimine |
| SMILES | C#CC(F)/C=C(\C=C/C)CN=C |
| InChI | InChI=1S/C10H12FN/c1-4-6-9(8-12-3)7-10(11)5-2/h2,4,6-7,10H,3,8H2,1H3/b6-4-,9-7+ |
| InChIKey | TZFCCQROPBQXEQ-UNQQQNFISA-N |
| XLogP | 2.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|